| Name |
2,3,5,6-Tetrabromo-p-xylene-d6
|
| Molecular Formula |
C8H6Br4
|
| Molecular Weight |
427.79
|
| Smiles |
Cc1c(Br)c(Br)c(C)c(Br)c1Br
|
Cc1c(Br)c(Br)c(C)c(Br)c1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.