| Name |
1-({6-Chloroimidazo[1,2-a]pyridin-2-yl}methyl)-1,4-diazepane dihydrochloride
|
| Molecular Formula |
C13H19Cl3N4
|
| Molecular Weight |
337.7
|
| Smiles |
Cl.Cl.Clc1ccc2nc(CN3CCCNCC3)cn2c1
|
Cl.Cl.Clc1ccc2nc(CN3CCCNCC3)cn2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.