| Name |
3-{3-[(4-Ethoxyphenyl)amino]-2,5-dioxoazolidinyl}benzoic acid
|
| Molecular Formula |
C19H18N2O5
|
| Molecular Weight |
354.4
|
| Smiles |
CCOc1ccc(NC2CC(=O)N(c3cccc(C(=O)O)c3)C2=O)cc1
|
CCOc1ccc(NC2CC(=O)N(c3cccc(C(=O)O)c3)C2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.