| Name |
[4-(3,5-dimethoxyphenyl)-1,1-dioxido-4H-1,4-benzothiazin-2-yl](4-ethoxyphenyl)methanone
|
| Molecular Formula |
C25H23NO6S
|
| Molecular Weight |
465.5
|
| Smiles |
CCOc1ccc(C(=O)C2=CN(c3cc(OC)cc(OC)c3)c3ccccc3S2(=O)=O)cc1
|
CCOc1ccc(C(=O)C2=CN(c3cc(OC)cc(OC)c3)c3ccccc3S2(=O)=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.