| Name |
(4Z)-1,1,1,2,4,5,6,7,7,7-Decafluoro-2,6-bis(trifluoromethyl)hept-4-en-3-one
|
| Molecular Formula |
C9F16O
|
| Molecular Weight |
428.07
|
| Smiles |
O=C(C(F)=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F
|
O=C(C(F)=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.