| Name |
Diisopropyl{1-[(S)-2,6-dimethyl-3,5-dioxa-4-phospha-cyclohepta(2,1-a;3,4-a')di-naphtalen-4-yl]-3-methyl-2-indolyl}phosphine
|
| Molecular Formula |
C37H37NO2P2
|
| Molecular Weight |
589.6
|
| Smiles |
Cc1c(P(C(C)C)C(C)C)n(-p2oc3c(C)cc4ccccc4c3c3c(o2)c(C)cc2ccccc23)c2ccccc12
|
Cc1c(P(C(C)C)C(C)C)n(-p2oc3c(C)cc4ccccc4c3c3c(o2)c(C)cc2ccccc23)c2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.