| Name |
N-(3,4-dimethylphenyl)-2-{3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]-2-oxo-1,2-dihydropyridin-1-yl}acetamide
|
| Molecular Formula |
C24H22N4O3
|
| Molecular Weight |
414.5
|
| Smiles |
Cc1ccc(-c2noc(-c3cccn(CC(=O)Nc4ccc(C)c(C)c4)c3=O)n2)cc1
|
Cc1ccc(-c2noc(-c3cccn(CC(=O)Nc4ccc(C)c(C)c4)c3=O)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.