| Name |
1-((3-(4-(Methylthio)phenyl)-1,2,4-oxadiazol-5-yl)methyl)-8-(thiophen-2-yl)pyrazolo[1,5-d][1,2,4]triazinone
|
| Molecular Formula |
C19H14N6O2S2
|
| Molecular Weight |
422.5
|
| Smiles |
CSc1ccc(-c2noc(Cn3ncn4nc(-c5cccs5)cc4c3=O)n2)cc1
|
CSc1ccc(-c2noc(Cn3ncn4nc(-c5cccs5)cc4c3=O)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.