| Name |
Sodium 4-chloro-alpha,alpha-bis(3,5-dichloro-2-hydroxyphenyl)-o-toluenesulfonate
|
| Molecular Formula |
C19H10Cl5NaO5S
|
| Molecular Weight |
550.6
|
| Smiles |
O=S(=O)([O-])c1cc(Cl)ccc1C(c1cc(Cl)cc(Cl)c1O)c1cc(Cl)cc(Cl)c1O.[Na+]
|
O=S(=O)([O-])c1cc(Cl)ccc1C(c1cc(Cl)cc(Cl)c1O)c1cc(Cl)cc(Cl)c1O.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.