| Name |
3-(5-(benzo[d][1,3]dioxol-5-yl)-1,3,4-oxadiazol-2-yl)-N,N-dimethylpiperidine-1-sulfonamide
|
| Molecular Formula |
C16H20N4O5S
|
| Molecular Weight |
380.4
|
| Smiles |
CN(C)S(=O)(=O)N1CCCC(c2nnc(-c3ccc4c(c3)OCO4)o2)C1
|
CN(C)S(=O)(=O)N1CCCC(c2nnc(-c3ccc4c(c3)OCO4)o2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.