| Name |
N-(butan-2-yl)-2-{4-oxo-3-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3H,4H,5H-pyrimido[5,4-b]indol-5-yl}acetamide
|
| Molecular Formula |
C25H24N6O3
|
| Molecular Weight |
456.5
|
| Smiles |
CCC(C)NC(=O)Cn1c2ccccc2c2ncn(Cc3nc(-c4ccccc4)no3)c(=O)c21
|
CCC(C)NC(=O)Cn1c2ccccc2c2ncn(Cc3nc(-c4ccccc4)no3)c(=O)c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.