| Name |
4-({[2-(2,3-Dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}thio)-2-(2,5-dimethylphenyl)pyrazolo[1,5-a]pyrazine
|
| Molecular Formula |
C27H26N4O3S
|
| Molecular Weight |
486.6
|
| Smiles |
COc1cccc(-c2nc(CSc3nccn4nc(-c5cc(C)ccc5C)cc34)c(C)o2)c1OC
|
COc1cccc(-c2nc(CSc3nccn4nc(-c5cc(C)ccc5C)cc34)c(C)o2)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.