| Name |
4-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-(4-methoxyphenyl)phthalazin-1(2H)-one
|
| Molecular Formula |
C24H16N4O5
|
| Molecular Weight |
440.4
|
| Smiles |
COc1ccc(-n2nc(-c3nc(-c4ccc5c(c4)OCO5)no3)c3ccccc3c2=O)cc1
|
COc1ccc(-n2nc(-c3nc(-c4ccc5c(c4)OCO5)no3)c3ccccc3c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.