| Name |
2-Oxo-2-(2-oxo-1,2,3,4-tetrahydroquinolin-6-yl)ethyl 5,6-dichloropyridine-3-carboxylate
|
| Molecular Formula |
C17H12Cl2N2O4
|
| Molecular Weight |
379.2
|
| Smiles |
O=C1CCc2cc(C(=O)COC(=O)c3cnc(Cl)c(Cl)c3)ccc2N1
|
O=C1CCc2cc(C(=O)COC(=O)c3cnc(Cl)c(Cl)c3)ccc2N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.