| Name |
1-(4-(3-benzyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-7-yl)piperazin-1-yl)-4-phenylbutan-1-one
|
| Molecular Formula |
C25H27N7O
|
| Molecular Weight |
441.5
|
| Smiles |
O=C(CCCc1ccccc1)N1CCN(c2ncnc3c2nnn3Cc2ccccc2)CC1
|
O=C(CCCc1ccccc1)N1CCN(c2ncnc3c2nnn3Cc2ccccc2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.