| Name |
N-(5-oxo-2,3,4,5-tetrahydrobenzo[f][1,4]oxazepin-7-yl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide
|
| Molecular Formula |
C19H20N2O4S
|
| Molecular Weight |
372.4
|
| Smiles |
O=C1NCCOc2ccc(NS(=O)(=O)c3ccc4c(c3)CCCC4)cc21
|
O=C1NCCOc2ccc(NS(=O)(=O)c3ccc4c(c3)CCCC4)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.