| Name |
1,6:5,9:8,12:11,16-tetraanhydro-2,3,4,10,13,14-hexadeoxy-D-glycero-D-allo-D-gulo-heptadeca-2,13-dienitol
|
| Molecular Formula |
C17H24O7
|
| Molecular Weight |
340.4
|
| Smiles |
OCC1OC2CC3OC4CC=CCOC4C(O)C3OC2C=CC1O
|
OCC1OC2CC3OC4CC=CCOC4C(O)C3OC2C=CC1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.