| Name |
{[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]carbamoyl}methyl 6-chloropyridine-3-carboxylate
|
| Molecular Formula |
C19H16ClN3O5S
|
| Molecular Weight |
433.9
|
| Smiles |
COc1ccc(OC)c(-c2csc(NC(=O)COC(=O)c3ccc(Cl)nc3)n2)c1
|
COc1ccc(OC)c(-c2csc(NC(=O)COC(=O)c3ccc(Cl)nc3)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.