| Name |
3-[6-(3,4-dimethylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-N-{[4-(propan-2-yl)phenyl]methyl}propanamide
|
| Molecular Formula |
C26H29N5O
|
| Molecular Weight |
427.5
|
| Smiles |
Cc1ccc(-c2ccc3nnc(CCC(=O)NCc4ccc(C(C)C)cc4)n3n2)cc1C
|
Cc1ccc(-c2ccc3nnc(CCC(=O)NCc4ccc(C(C)C)cc4)n3n2)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.