| Name |
Benzyl-{3-[3-(3,4-dimethoxy-phenyl)-3-oxo-propyl]-phenyl}-dimethyl-ammonium; bromide
|
| Molecular Formula |
C26H30NO3+
|
| Molecular Weight |
404.5
|
| Smiles |
COc1ccc(C(=O)CCc2cccc([N+](C)(C)Cc3ccccc3)c2)cc1OC
|
COc1ccc(C(=O)CCc2cccc([N+](C)(C)Cc3ccccc3)c2)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.