| Name |
N-(5-((2,3-dihydrobenzo[b][1,4]dioxin-6-yl)methyl)-1,3,4-oxadiazol-2-yl)-2-(2,5-dimethylphenyl)acetamide
|
| Molecular Formula |
C21H21N3O4
|
| Molecular Weight |
379.4
|
| Smiles |
Cc1ccc(C)c(CC(=O)Nc2nnc(Cc3ccc4c(c3)OCCO4)o2)c1
|
Cc1ccc(C)c(CC(=O)Nc2nnc(Cc3ccc4c(c3)OCCO4)o2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.