| Name |
5-amino-1-{[2-(3-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-N-(3,5-dimethylphenyl)-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C22H21ClN6O2
|
| Molecular Weight |
436.9
|
| Smiles |
Cc1cc(C)cc(NC(=O)c2nnn(Cc3nc(-c4cccc(Cl)c4)oc3C)c2N)c1
|
Cc1cc(C)cc(NC(=O)c2nnn(Cc3nc(-c4cccc(Cl)c4)oc3C)c2N)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.