| Name |
5-amino-N-(3,5-dimethoxyphenyl)-1-{[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methyl}-1H-1,2,3-triazole-4-carboxamide
|
| Molecular Formula |
C23H24N6O5
|
| Molecular Weight |
464.5
|
| Smiles |
COc1ccc(-c2nc(Cn3nnc(C(=O)Nc4cc(OC)cc(OC)c4)c3N)c(C)o2)cc1
|
COc1ccc(-c2nc(Cn3nnc(C(=O)Nc4cc(OC)cc(OC)c4)c3N)c(C)o2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.