| Name |
N-(2-ethoxyphenyl)-2-{4-methyl-3,5-dioxo-2H,3H,4H,5H,6H-pyridazino[4,5-b][1,4]thiazin-6-yl}acetamide
|
| Molecular Formula |
C17H18N4O4S
|
| Molecular Weight |
374.4
|
| Smiles |
CCOc1ccccc1NC(=O)Cn1ncc2c(c1=O)N(C)C(=O)CS2
|
CCOc1ccccc1NC(=O)Cn1ncc2c(c1=O)N(C)C(=O)CS2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.