| Name |
N-(8,10-dimethyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepin-2-yl)benzenesulfonamide
|
| Molecular Formula |
C21H18N2O4S
|
| Molecular Weight |
394.4
|
| Smiles |
Cc1ccc2c(c1)N(C)C(=O)c1cc(NS(=O)(=O)c3ccccc3)ccc1O2
|
Cc1ccc2c(c1)N(C)C(=O)c1cc(NS(=O)(=O)c3ccccc3)ccc1O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.