| Name |
6-({[2-(2,6-Dichlorophenyl)-4-methyl-1,3-thiazol-5-yl]carbonyl}amino)hexanoic acid
|
| Molecular Formula |
C17H18Cl2N2O3S
|
| Molecular Weight |
401.3
|
| Smiles |
Cc1nc(-c2c(Cl)cccc2Cl)sc1C(=O)NCCCCCC(=O)O
|
Cc1nc(-c2c(Cl)cccc2Cl)sc1C(=O)NCCCCCC(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.