| Name |
N-cyclohexyl-2-({4-oxo-3-[2-(thiophen-2-yl)ethyl]-3,4-dihydrothieno[3,2-d]pyrimidin-2-yl}sulfanyl)acetamide
|
| Molecular Formula |
C20H23N3O2S3
|
| Molecular Weight |
433.6
|
| Smiles |
O=C(CSc1nc2ccsc2c(=O)n1CCc1cccs1)NC1CCCCC1
|
O=C(CSc1nc2ccsc2c(=O)n1CCc1cccs1)NC1CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.