| Name |
N-(furan-2-ylmethyl)-4-oxo-8-phenyl-4,6,7,8-tetrahydroimidazo[2,1-c][1,2,4]triazine-3-carboxamide
|
| Molecular Formula |
C17H15N5O3
|
| Molecular Weight |
337.33
|
| Smiles |
O=C(NCc1ccco1)c1nnc2n(c1=O)CCN2c1ccccc1
|
O=C(NCc1ccco1)c1nnc2n(c1=O)CCN2c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.