| Name |
N-(3,4-dimethylphenyl)-2-(4-(3-fluorophenyl)-1,1-dioxido-3,4-dihydro-2H-pyrido[2,3-e][1,2,4]thiadiazin-2-yl)acetamide
|
| Molecular Formula |
C22H21FN4O3S
|
| Molecular Weight |
440.5
|
| Smiles |
Cc1ccc(NC(=O)CN2CN(c3cccc(F)c3)c3ncccc3S2(=O)=O)cc1C
|
Cc1ccc(NC(=O)CN2CN(c3cccc(F)c3)c3ncccc3S2(=O)=O)cc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.