| Name |
1'-[1-(3-Ethylphenyl)-5-(pyridin-3-YL)-1H-1,2,3-triazole-4-carbonyl]-1,4'-bipiperidine
|
| Molecular Formula |
C26H32N6O
|
| Molecular Weight |
444.6
|
| Smiles |
CCc1cccc(-n2nnc(C(=O)N3CCC(N4CCCCC4)CC3)c2-c2cccnc2)c1
|
CCc1cccc(-n2nnc(C(=O)N3CCC(N4CCCCC4)CC3)c2-c2cccnc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.