| Name |
2h-Pyrrolo[2,3-b]pyridine-2,4,6(5h,7h)-trione,5-ethyl-3,3a-dihydro-3-methyl-
|
| Molecular Formula |
C10H12N2O3
|
| Molecular Weight |
208.21
|
| Smiles |
CCC1C(=O)NC2=NC(=O)C(C)C2C1=O
|
CCC1C(=O)NC2=NC(=O)C(C)C2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.