| Name |
3-{[4-(3-methoxyphenyl)piperazino]carbonyl}-6-methylisothiazolo[4,3-d]pyrimidine-5,7(4H,6H)-dione
|
| Molecular Formula |
C18H19N5O4S
|
| Molecular Weight |
401.4
|
| Smiles |
COc1cccc(N2CCN(C(=O)c3snc4c(=O)n(C)c(=O)[nH]c34)CC2)c1
|
COc1cccc(N2CCN(C(=O)c3snc4c(=O)n(C)c(=O)[nH]c34)CC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.