| Name |
(3-{3-[1-(4-fluorophenyl)-5-methyl-1H-1,2,3-triazol-4-yl]-1,2,4-oxadiazol-5-yl}phenyl)dimethylamine
|
| Molecular Formula |
C19H17FN6O
|
| Molecular Weight |
364.4
|
| Smiles |
Cc1c(-c2noc(-c3cccc(N(C)C)c3)n2)nnn1-c1ccc(F)cc1
|
Cc1c(-c2noc(-c3cccc(N(C)C)c3)n2)nnn1-c1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.