| Name |
5-(4-chlorobenzoyl)-2,3-dihydro-1H-1,3-benzodiazol-2-one
|
| Molecular Formula |
C14H9ClN2O2
|
| Molecular Weight |
272.68
|
| Smiles |
O=C(c1ccc(Cl)cc1)c1ccc2[nH]c(=O)[nH]c2c1
|
O=C(c1ccc(Cl)cc1)c1ccc2[nH]c(=O)[nH]c2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.