| Name |
9-(1,1-dioxidotetrahydrothiophen-3-yl)-3-(2-methoxyphenoxy)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one
|
| Molecular Formula |
C22H21NO7S
|
| Molecular Weight |
443.5
|
| Smiles |
COc1ccccc1Oc1coc2c3c(ccc2c1=O)OCN(C1CCS(=O)(=O)C1)C3
|
COc1ccccc1Oc1coc2c3c(ccc2c1=O)OCN(C1CCS(=O)(=O)C1)C3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.