| Name |
6-chloro-N-(5-methyl-4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)-4-oxo-4H-chromene-2-carboxamide
|
| Molecular Formula |
C18H15ClN2O4
|
| Molecular Weight |
358.8
|
| Smiles |
CC1CCc2noc(NC(=O)c3cc(=O)c4cc(Cl)ccc4o3)c2C1
|
CC1CCc2noc(NC(=O)c3cc(=O)c4cc(Cl)ccc4o3)c2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.