| Name |
2-(3-methyl-7-oxo-3H-[1,2,3]triazolo[4,5-d]pyrimidin-6(7H)-yl)-N-((tetrahydrofuran-2-yl)methyl)acetamide
|
| Molecular Formula |
C12H16N6O3
|
| Molecular Weight |
292.29
|
| Smiles |
Cn1nnc2c(=O)n(CC(=O)NCC3CCCO3)cnc21
|
Cn1nnc2c(=O)n(CC(=O)NCC3CCCO3)cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.