| Name |
7-benzyl-6-{[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]sulfanyl}-2H,7H,8H-[1,3]dioxolo[4,5-g]quinazolin-8-one
|
| Molecular Formula |
C25H18N4O4S
|
| Molecular Weight |
470.5
|
| Smiles |
O=c1c2cc3c(cc2nc(SCc2nc(-c4ccccc4)no2)n1Cc1ccccc1)OCO3
|
O=c1c2cc3c(cc2nc(SCc2nc(-c4ccccc4)no2)n1Cc1ccccc1)OCO3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.