| Name |
S-(4-chlorophenyl) 3-phenyl-5,6-dihydro-1,4-oxathiine-2-carbothioate 4,4-dioxide
|
| Molecular Formula |
C17H13ClO4S2
|
| Molecular Weight |
380.9
|
| Smiles |
O=C(Sc1ccc(Cl)cc1)C1=C(c2ccccc2)S(=O)(=O)CCO1
|
O=C(Sc1ccc(Cl)cc1)C1=C(c2ccccc2)S(=O)(=O)CCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.