| Name |
2,4'-Diamino-6-methyl-4-(2'-pyridyl)pyrimidine
|
| Molecular Formula |
C10H11N5
|
| Molecular Weight |
201.23
|
| Smiles |
Cc1cc(-c2cc(N)ccn2)nc(N)n1
|
Cc1cc(-c2cc(N)ccn2)nc(N)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.