| Name |
N3,N5-Bis(2,2-difluoroethyl)-1-methyl-1H-pyrazole-3,5-dicarboxamide
|
| Molecular Formula |
C10H12F4N4O2
|
| Molecular Weight |
296.22
|
| Smiles |
Cn1nc(C(=O)NCC(F)F)cc1C(=O)NCC(F)F
|
Cn1nc(C(=O)NCC(F)F)cc1C(=O)NCC(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.