| Name |
2-Amino-9-((2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxytetrahydrofuran-2-yl)-7-methyl-9H-purin-7-ium-6-olate
|
| Molecular Formula |
C12H17N5O5
|
| Molecular Weight |
311.29
|
| Smiles |
COC1C(O)C(CO)OC1[n+]1cn(C)c2c([O-])nc(N)nc21
|
COC1C(O)C(CO)OC1[n+]1cn(C)c2c([O-])nc(N)nc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.