| Name |
2-(2,5-dimethoxyphenyl)-5,10-dimethyl-2,3-dihydro-4H,8H-pyrano[2,3-f]chromene-4,8-dione
|
| Molecular Formula |
C22H20O6
|
| Molecular Weight |
380.4
|
| Smiles |
COc1ccc(OC)c(C2CC(=O)c3c(C)cc4oc(=O)cc(C)c4c3O2)c1
|
COc1ccc(OC)c(C2CC(=O)c3c(C)cc4oc(=O)cc(C)c4c3O2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.