| Name |
5,10-dimethyl-2-(2,3,4-trimethoxyphenyl)-2,3-dihydro-4H,8H-pyrano[2,3-f]chromene-4,8-dione
|
| Molecular Formula |
C23H22O7
|
| Molecular Weight |
410.4
|
| Smiles |
COc1ccc(C2CC(=O)c3c(C)cc4oc(=O)cc(C)c4c3O2)c(OC)c1OC
|
COc1ccc(C2CC(=O)c3c(C)cc4oc(=O)cc(C)c4c3O2)c(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.