| Name |
6-(2H-1,3-benzodioxol-5-yl)-2-(2-{3-[4-(propan-2-yloxy)phenyl]-1,2,4-oxadiazol-5-yl}ethyl)-2,3-dihydropyridazin-3-one
|
| Molecular Formula |
C24H22N4O5
|
| Molecular Weight |
446.5
|
| Smiles |
CC(C)Oc1ccc(-c2noc(CCn3nc(-c4ccc5c(c4)OCO5)ccc3=O)n2)cc1
|
CC(C)Oc1ccc(-c2noc(CCn3nc(-c4ccc5c(c4)OCO5)ccc3=O)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.