| Name |
3-(4-Methoxyphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole hydrochloride
|
| Molecular Formula |
C13H15ClN2O
|
| Molecular Weight |
250.72
|
| Smiles |
COc1ccc(-c2cnc3n2CCC3)cc1.Cl
|
COc1ccc(-c2cnc3n2CCC3)cc1.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.