| Name |
1-(10-Methyl-11-oxo-10,11-dihydrodibenzo[b,f][1,4]oxazepin-2-yl)-3-(3,4,5-trimethoxyphenyl)urea
|
| Molecular Formula |
C24H23N3O6
|
| Molecular Weight |
449.5
|
| Smiles |
COc1cc(NC(=O)Nc2ccc3c(c2)C(=O)N(C)c2ccccc2O3)cc(OC)c1OC
|
COc1cc(NC(=O)Nc2ccc3c(c2)C(=O)N(C)c2ccccc2O3)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.