| Name |
2-imino-N~3~-(2-methoxyphenyl)-5-oxo-1-phenethyl-1,5-dihydro-2H-dipyrido[1,2-a:2,3-d]pyrimidine-3-carboxamide
|
| Molecular Formula |
C27H23N5O3
|
| Molecular Weight |
465.5
|
| Smiles |
COc1ccccc1NC(=O)c1cc2c(=O)n3ccccc3nc2n(CCc2ccccc2)c1=N
|
COc1ccccc1NC(=O)c1cc2c(=O)n3ccccc3nc2n(CCc2ccccc2)c1=N
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.