| Name |
1-(5-(2,5-Dimethylphenyl)-1,3,4-oxadiazol-2-yl)-3-(3,4,5-trimethoxyphenyl)urea
|
| Molecular Formula |
C20H22N4O5
|
| Molecular Weight |
398.4
|
| Smiles |
COc1cc(NC(=O)Nc2nnc(-c3cc(C)ccc3C)o2)cc(OC)c1OC
|
COc1cc(NC(=O)Nc2nnc(-c3cc(C)ccc3C)o2)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.