| Name |
N-(4-amino-3,5-dichlorophenyl)-3-[4,6-dimethyl-2-(methylsulfanyl)pyrimidin-5-yl]propanamide
|
| Molecular Formula |
C16H18Cl2N4OS
|
| Molecular Weight |
385.3
|
| Smiles |
CSc1nc(C)c(CCC(=O)Nc2cc(Cl)c(N)c(Cl)c2)c(C)n1
|
CSc1nc(C)c(CCC(=O)Nc2cc(Cl)c(N)c(Cl)c2)c(C)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.